Aug 30/31 updates. Tinkering with shared_ptr. Working towards exposing UI objects to Python UI. Color object updated for shared_ptr structure that will be repeated for the rest of the UI objects. Still a lot of open questions, but committing here to get back on track after a few hours wasted trying to solve this problem too generally via templates.

This commit is contained in:
John McCardle 2023-08-31 13:51:56 -04:00
commit 50d926fe37
11 changed files with 293 additions and 137 deletions

View file

@ -10,27 +10,33 @@ void UIDrawable::render()
UIFrame::UIFrame():
x(0), y(0), w(0), h(0), outline(0)
{
/*
pyOutlineColor = NULL;
pyFillColor = NULL;
_outlineColor = NULL;
_fillColor = NULL;
*/
}
UIFrame::UIFrame(float _x, float _y, float _w, float _h):
x(_x), y(_y), w(_w), h(_h), outline(0)
{
/*
pyOutlineColor = NULL;
pyFillColor = NULL;
_outlineColor = NULL;
_fillColor = NULL;
*/
}
UIFrame::~UIFrame()
{
/*
if (pyOutlineColor) Py_DECREF(pyOutlineColor);
else if (_outlineColor) delete _outlineColor;
if (pyFillColor) Py_DECREF(pyFillColor);
else if (_fillColor) delete _fillColor;
*/
}
/*
@ -43,68 +49,23 @@ UIFrame::~UIFrame()
void outlineColor(PyObject* pyColor); // Python setter
*/
sf::Color UIFrame::fillColor()
{
if (_fillColor == NULL) return sf::Color();
return *_fillColor;
}
void UIFrame::fillColor(sf::Color c)
{
if (pyFillColor) { Py_DECREF(pyFillColor); }
else { delete _fillColor; }
_fillColor = new sf::Color(c.r, c.g, c.b, c.a);
pyFillColor = NULL;
}
void UIFrame::fillColor(PyColorObject* pyColor)
{
if (pyFillColor) { Py_DECREF(pyFillColor); }
else { delete _fillColor; }
Py_INCREF(pyColor);
pyFillColor = pyColor;
_fillColor = &(pyFillColor->color);
}
sf::Color UIFrame::outlineColor()
{
if (_outlineColor == NULL) return sf::Color();
return *_outlineColor;
}
void UIFrame::outlineColor(sf::Color c)
{
if (pyOutlineColor) { Py_DECREF(pyOutlineColor); }
else { delete _outlineColor; }
_outlineColor = new sf::Color(c.r, c.g, c.b, c.a);
pyOutlineColor = NULL;
}
void UIFrame::outlineColor(PyColorObject* pyColor)
{
if (pyOutlineColor) { Py_DECREF(pyOutlineColor); }
else { delete _outlineColor; }
Py_INCREF(pyColor);
pyOutlineColor = pyColor;
_outlineColor = &(pyOutlineColor->color);
}
void UIFrame::render(sf::Vector2f offset)
{
//std::cout << "Rendering UIFrame w/ offset " << offset.x << ", " << offset.y << "\n";
//std::cout << "position = " << x << ", " << y << "\n";
//box.move(offset);
//Resources::game->getWindow().draw(box);
//box.move(-offset);
sf::RectangleShape box = sf::RectangleShape(sf::Vector2f(w,h));
sf::Vector2f pos = sf::Vector2f(x, y);
box.setPosition(offset + pos);
if (_fillColor) { box.setFillColor(fillColor()); }
if (_outlineColor) { box.setOutlineColor(outlineColor()); }
box.setOutlineThickness(outline);
box.move(offset);
Resources::game->getWindow().draw(box);
box.move(-offset);
//sf::RectangleShape box = sf::RectangleShape(sf::Vector2f(w,h));
//sf::Vector2f pos = sf::Vector2f(x, y);
//box.setPosition(offset + pos);
//if (_fillColor) { box.setFillColor(fillColor()); }
//if (_outlineColor) { box.setOutlineColor(outlineColor()); }
//box.setOutlineThickness(outline);
//Resources::game->getWindow().draw(box);
for (auto drawable : children) {
drawable->render(offset + pos);
drawable->render(offset + box.getPosition());
}
}
@ -121,4 +82,4 @@ void UISprite::render(sf::Vector2f offset)
sprite.move(offset);
Resources::game->getWindow().draw(sprite);
sprite.move(-offset);
}
}